5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
Iphuzu elibilayo | 116-118 °C/33 mmHg (lit.) |
ukuminyana | 1.49 g/mL at 25 °C (lit.) |
inkomba ye-refractive | n20/D 1.492(lit.) |
Fp | 225 °F |
ifomu | clear liquid |
Specific Gravity | 1.49 |
umbala | Colorless to Light yellow to Light orange |
Ukuncibilika kwamanzi | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. Ingabe uyimboni noma inkampani yokuhweba?
Siyimboni ehlanganisa i-comnay kanye nezohwebo, sinikeza isevisi eyodwa-stop.OEM ingamukelwa.
2. Uyawahlinzeka ngamasampula? Ingabe imahhala noma ingeziwe?
Amasampula wamahhala.Imali yesampula yempahla idinga ukukhokhwa eceleni kwakho.
3. Ingabe unazo izitifiketi ezihlobene nokulawulwa kwekhwalithi?
Isitifiketi se-ISO 9001:2008 sokuqinisekisa ikhwalithi.
4. Yini okufanele ngiyinikeze ukuze ngithole ikhotheshini?
I-Pls isazise ngohlobo lomkhiqizo oludingayo, inani le-oda, ikheli kanye nezidingo ezithile. Ikhotheshini izokwenzelwa inkomba yakho ngokuhamba kwesikhathi.
5. Hlobo luni lwendlela yokukhokha olukhethayo? Hlobo luni lwamagama olwamukelwayo?
Imigomo Eyamukelwe Yokulethwa: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
Uhlobo Lwenkokhelo olwamukelwe: T/T,Western Union; I-Paypal, Isiqinisekiso Sokuhweba.
Ulimi olukhulunywayo:IsiNgisi.
Izigaba zemikhiqizo