5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
Kiehumispiste | 116-118 °C/33 mmHg (lit.) |
tiheys | 1.49 g/mL at 25 °C (lit.) |
taitekerroin | n20/D 1.492(lit.) |
Fp | 225 °F |
muodossa | clear liquid |
Specific Gravity | 1.49 |
väri | Colorless to Light yellow to Light orange |
Vesiliukoisuus | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. Oletko tehdas vai kauppayhtiö?
Olemme teollisuuden ja kaupan yhdistävä yritys, joka tarjoaa yhden luukun palvelua. OEM voidaan hyväksyä.
2. Toimitatko näytteitä? Onko se ilmainen vai ylimääräinen?
Ilmaiset näytteet. Näytteen rahtimaksu on maksettava puolellasi.
3. Onko sinulla laadunvalvontaan liittyviä sertifikaatteja?
ISO 9001:2008 -sertifikaatti laadun takaamiseksi.
4. Mitä minun tulee toimittaa saadakseni tarjouksen?
Pls ilmoittaa meille tarvitsemasi tuotetyypistä, tilausmäärästä, osoitteesta ja erityisvaatimuksista. Tarjous tehdään viitteellesi ajoissa.
5. Millaista maksutapaa pidät parempana? Millaisia ehtoja hyväksytään?
Hyväksytyt toimitusehdot: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
Hyväksytty maksutyyppi: T / T, Western Union; Paypal, kaupan vakuutus.
Puhuttu kieli: Englanti.
Tuoteluokat