5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
Нуқтаи ҷӯшон | 116-118 °C/33 mmHg (lit.) |
зичии | 1.49 g/mL at 25 °C (lit.) |
шохиси шикастан | n20/D 1.492(lit.) |
Фп | 225 °F |
шакл | clear liquid |
Specific Gravity | 1.49 |
ранг | Colorless to Light yellow to Light orange |
Ҳалшавандагии об | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. Оё шумо корхона ё ширкати тиҷоратӣ ҳастед?
Мо як ширкате ҳастем, ки саноат ва савдоро муттаҳид карда, хидмати ягонаро пешниҳод мекунем. OEM метавонад қабул карда шавад.
2. Оё шумо намунаҳо пешниҳод мекунед? Оё он ройгон ё иловагӣ?
Намунаҳои ройгон. Пардохти боркашонии намуна бояд аз ҷониби шумо пардохт карда шавад.
3. Оё шумо ягон сертификати марбут ба назорати сифат доред?
Сертификати ISO 9001: 2008 барои таъмини сифат.
4. Барои гирифтани нархнома чиро бояд пешниҳод кунам?
Лутфан ба мо дар бораи намуди маҳсулоте, ки ба шумо лозим аст, миқдори фармоиш, суроға ва талаботи мушаххасро ба мо хабар диҳед. Иқтибос барои истинод ба шумо сари вақт дода мешавад.
5. Кадом намуди пардохти шумо бартарӣ доред? Кадом шартҳо қабул карда мешаванд?
Шартҳои қабули интиқол: FOB, CFR, CIF, EXW;
Accepted Payment Currency:USD;EUR
Намуди пардохти қабулшуда: T/T, Western Union; PayPal, Кафолати тиҷорат.
Забони гуфтугӯ: англисӣ.
Категорияҳои маҳсулот