5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
نقطة الغليان | 116-118 °C/33 mmHg (lit.) |
كثافة | 1.49 g/mL at 25 °C (lit.) |
معامل الانكسار | n20/D 1.492(lit.) |
Fp | 225 °F |
استمارة | clear liquid |
Specific Gravity | 1.49 |
لون | Colorless to Light yellow to Light orange |
الذوبان في الماء | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. هل أنت مصنع أو شركة تجارية؟
نحن شركة تدمج الصناعة والتجارة، ونقدم خدمة شاملة. ويمكن قبول OEM.
2. هل تقدم عينات؟ هل هو مجاني أم إضافي؟
عينات مجانية. يجب دفع رسوم شحن العينة من جانبكم.
3. هل لديك أي شهادات تتعلق بمراقبة الجودة؟
شهادة الأيزو 9001:2008 لضمان الجودة.
4. ما الذي يجب أن أقدمه للحصول على عرض أسعار؟
يرجى إبلاغنا بنوع المنتج الذي تحتاجه وكمية الطلب والعنوان والمتطلبات المحددة. سيتم تقديم عرض الأسعار للرجوع إليه في الوقت المناسب.
5. ما نوع طريقة الدفع التي تفضلها؟ ما نوع الشروط المقبولة؟
شروط التسليم المقبولة: FOB، CFR، CIF، EXW؛
Accepted Payment Currency:USD;EUR
نوع الدفع المقبول: T/T، ويسترن يونيون؛ باي بال، ضمان التجارة.
اللغة المُتحدث بها: الانجليزية.
فئات المنتجات