5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
Qaynama nöqtəsi | 116-118 °C/33 mmHg (lit.) |
sıxlıq | 1.49 g/mL at 25 °C (lit.) |
qırılma əmsalı | n20/D 1.492(lit.) |
Fp | 225 °F |
forma | clear liquid |
Specific Gravity | 1.49 |
rəng | Colorless to Light yellow to Light orange |
Suda həllolma | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. Siz fabrik və ya ticarət şirkətisiniz?
Biz sənaye və ticarəti birləşdirən, bir pəncərədən xidmət göstərən bir şirkətik. OEM qəbul edilə bilər.
2. Siz nümunələr təqdim edirsiniz? Pulsuzdur yoxsa əlavə?
Pulsuz nümunələr. Nümunənin yük haqqı sizin tərəfinizdən ödənilməlidir.
3. Keyfiyyətə nəzarətlə bağlı hər hansı sertifikatlarınız varmı?
Keyfiyyəti təmin etmək üçün ISO 9001:2008 sertifikatı.
4. Kotirovka almaq üçün nə təqdim etməliyəm?
Lütfən, bizə lazım olan məhsul növü, sifariş miqdarı, ünvanı və xüsusi tələblər barədə məlumat verin. Kotirovka sizin arayışınız üçün vaxtında hazırlanacaq.
5. Hansı ödəniş üsuluna üstünlük verirsiniz? Hansı şərtlər qəbul edilir?
Qəbul edilmiş Çatdırılma Şərtləri: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
Qəbul edilən Ödəniş Növü: T/T, Western Union; Paypal, Ticarət Təminatı.
Danışıq dili: İngilis dili.
Məhsul kateqoriyaları