5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
Եռման կետ | 116-118 °C/33 mmHg (lit.) |
խտությունը | 1.49 g/mL at 25 °C (lit.) |
բեկման ինդեքս | n20/D 1.492(lit.) |
Fp | 225 °F |
ձեւը | clear liquid |
Specific Gravity | 1.49 |
գույն | Colorless to Light yellow to Light orange |
Ջրի լուծելիություն | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. Դուք գործարան կամ առևտրային ընկերություն եք:
Մենք ընկերություն ենք, որը ինտեգրում է արդյունաբերությունը և առևտուրը՝ տրամադրելով մեկ կանգառի ծառայություն: OEM-ը կարող է ընդունվել:
2. Դուք տալիս եք նմուշներ: Դա անվճար է, թե հավելյալ:
Անվճար նմուշներ: Նմուշի բեռնափոխադրման վճարը պետք է վճարվի ձեր կողմից:
3. Ունե՞ք որակի վերահսկման հետ կապված վկայականներ:
ISO 9001:2008 սերտիֆիկացում որակի ապահովման համար:
4. Ի՞նչ պետք է տրամադրեմ գնանշում ստանալու համար:
Խնդրում ենք տեղեկացնել մեզ ձեզ անհրաժեշտ ապրանքի տեսակի, պատվերի քանակի, հասցեի և հատուկ պահանջների մասին: Գնանշումը կկատարվի ժամանակին ձեր հղման համար:
5. Ինչպիսի՞ վճարման եղանակ եք նախընտրում: Ինչպիսի՞ պայմաններ են ընդունվում:
Ընդունված առաքման պայմաններ՝ FOB, CFR, CIF, EXW;
Accepted Payment Currency:USD;EUR
Ընդունված վճարման տեսակը՝ T/T, Western Union; Paypal, Առևտրի երաշխիք:
Խոսակցական լեզուն՝ անգլերեն:
Ապրանքների կատեգորիաներ