5-Bromovaleryl chloride is a chemical compound that functions as an acylating agent in organic synthesis. It is used to introduce the 5-bromovaleryl group into various organic molecules, allowing for the modification of their chemical properties. The mode of action of 5-Bromovaleryl chloride involves the substitution of the hydroxyl group in organic compounds with the 5-bromovaleryl group, leading to the formation of new chemical bonds. This process can be utilized to create novel compounds with specific functional groups for further study and analysis.
5-Bromovaleryl chloride was used in the preparation of aromatic azides and organic gelators.
We have many high-quality factories with deep cooperation, which can provide you with high quality products and competitive prices. And we can also give discounts for bulk purchases.And we cooperate with many professional freight forwarding companies, can deliver products safely and smoothly to your hands. Delivery time is about 3-20 days after confirmation of payment
Product Name: | 5-Bromovaleryl chloride |
Synonyms: | 5-Bromopentanoyl chloride 98%;5-broMo-aMyl chloride;5-BroMovaleryl chloride, 98% 5GR;5-BroMobalery chloride;5-BROMOPENTANOYL CHLORIDE;5-BROMOVALEROYL CHLORIDE;5-BROMOVALERYL CHLORIDE;5-Bromovaleryl chloride,98% |
CAS: | 4509-90-4 |
MF: | C5H8BrClO |
MW: | 199.47 |
EINECS: | 629-364-4 |
Product Categories: | Pyrrolines |
Mol File: | 4509-90-4.mol |
![]() |
5-Bromovaleryl chloride Chemical Properties |
ٽهڪندڙ نقطو | 116-118 °C/33 mmHg (lit.) |
کثافت | 1.49 g/mL at 25 °C (lit.) |
refractive انڊيڪس | n20/D 1.492(lit.) |
ايف پي | 225 °F |
فارم | clear liquid |
Specific Gravity | 1.49 |
رنگ | Colorless to Light yellow to Light orange |
پاڻي جي حل ڪرڻ | Reacts with water. |
Sensitive | Moisture Sensitive/Lachrymatory |
InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
SMILES | C(Cl)(=O)CCCCBr |
1. ڇا توهان هڪ ڪارخانو يا هڪ واپاري ڪمپني آهي؟
اسان صنعت ۽ واپار کي ضم ڪرڻ واري ڪمپني آهيون، هڪ اسٽاپ سروس فراهم ڪري رهيا آهيون.OEM قبول ڪري سگهجي ٿو.
2. ڇا توهان نموني مهيا ڪندا آهيو؟ ڇا اهو مفت يا اضافي آهي؟
مفت نموني. نموني جي مال جي فيس توهان جي پاسي کان ادا ڪرڻ جي ضرورت آهي.
3. ڇا توهان وٽ ڪيفيت ڪنٽرول سان لاڳاپيل سرٽيفڪيٽ آهن؟
معيار کي يقيني بڻائڻ لاء ISO 9001: 2008 سرٽيفڪيشن.
4. مون کي اقتباس حاصل ڪرڻ لاء ڇا مهيا ڪرڻ گهرجي؟
مهرباني ڪري اسان کي پروڊڪٽ جي قسم جي ڄاڻ ڏيو جنهن جي توهان کي ضرورت آهي، آرڊر جي مقدار، ايڊريس ۽ مخصوص گهرجن. ڪوٽا توهان جي حوالي سان وقت ۾ ڪئي ويندي.
5. توهان ڪهڙي قسم جي ادائگي جو طريقو پسند ڪندا آهيو؟ ڪهڙي قسم جا شرط قبول ڪيا ويا آهن؟
قبول ٿيل پهچائڻ جون شرطون: FOB، CFR، CIF، EXW؛
Accepted Payment Currency:USD;EUR
قبول ٿيل ادائگي جو قسم: T/T، ويسٽرن يونين؛ Paypal، واپار جي ضمانت.
ڳالهائيندڙ ٻولي: انگريزي.
مصنوعات جا زمرا