MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
ඔබට උසස් තත්ත්වයේ නිෂ්පාදන සහ තරඟකාරී මිල ගණන් ලබා දිය හැකි ගැඹුරු සහයෝගීතාවයකින් යුත් උසස් තත්ත්වයේ කර්මාන්තශාලා රාශියක් අප සතුව ඇත. තවද අපට තොග මිල දී ගැනීම් සඳහා වට්ටම් ලබා දිය හැකිය. තවද අපි බොහෝ වෘත්තීය භාණ්ඩ ප්රවාහන සමාගම් සමඟ සහයෝගයෙන් කටයුතු කරන අතර, නිෂ්පාදන ආරක්ෂිතව සහ සුමටව ඔබේ අතට ලබා දිය හැකිය. ගෙවීම තහවුරු කිරීමෙන් පසු භාරදීමේ කාලය දින 3-20 පමණ වේ.
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS: | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
ද්රවාංකය | >90°C (dec.) |
තාපාංකය | 873.5±65.0 °C(Predicted) |
ඝනත්වය | 1.088±0.06 g/cm3(Predicted) |
ගබඩා උෂ්ණත්වය. | -20°C Freezer |
ද්රාව්යතාව | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
ආකෘතිය | Solid |
වර්ණය | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. ඔබ කර්මාන්ත ශාලාවක් හෝ වෙළඳ සමාගමක් ද?
අපි එක්-නැවතුම් සේවාවක් සපයන කර්මාන්තය සහ වෙළඳාම ඒකාබද්ධ කරන සමාගමකි.OEM පිළිගත හැකිය.
2. ඔබ සාම්පල සපයනවාද? එය නොමිලේ හෝ අමතරද?
නොමිලේ සාම්පල. සාම්පලයේ භාණ්ඩ ප්රවාහන ගාස්තුව ඔබේ පැත්තෙන් ගෙවිය යුතුය.
3. තත්ත්ව පාලනයට අදාළ සහතික ඔබ සතුව තිබේද?
ISO 9001:2008 තත්ත්ව සහතිකය සහතික කිරීම.
4. මිල කැඳවීමක් ලබා ගැනීමට මා සැපයිය යුත්තේ කුමක්ද?
Pls ඔබට අවශ්ය නිෂ්පාදන වර්ගය, ඇණවුම් ප්රමාණය, ලිපිනය සහ නිශ්චිත අවශ්යතා පිළිබඳව අපට දන්වන්න. උද්ධෘතය නියමිත වේලාවට ඔබේ යොමු කිරීම සඳහා කරනු ලැබේ.
5. ඔබ කැමති කුමන ආකාරයේ ගෙවීම් ක්රමයක්ද? කුමන ආකාරයේ කොන්දේසි පිළිගනු ලැබේද?
පිළිගත් බෙදාහැරීමේ කොන්දේසි: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
පිළිගත් ගෙවීම් වර්ගය: T/T,Western Union; Paypal, වෙළඳ සහතිකය.
කතා කරන භාෂාව: ඉංග්රීසි.
නිෂ්පාදන කාණ්ඩ