MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
ଗଭୀର ସହଯୋଗ ସହିତ ଆମର ଅନେକ ଉଚ୍ଚ-ଗୁଣାତ୍ମକ କାରଖାନା ଅଛି, ଯାହା ଆପଣଙ୍କୁ ଉଚ୍ଚମାନର ଉତ୍ପାଦ ଏବଂ ପ୍ରତିଯୋଗିତାମୂଳକ ମୂଲ୍ୟ ପ୍ରଦାନ କରିପାରିବ | ଏବଂ ଆମେ ବହୁଳ କ୍ରୟ ପାଇଁ ରିହାତି ମଧ୍ୟ ଦେଇପାରିବା | ଏବଂ ଆମେ ଅନେକ ପେସାଦାର ମାଲ ପରିବହନ ଫରୱାର୍ଡିଂ କମ୍ପାନୀଗୁଡିକ ସହିତ ସହଯୋଗ କରୁ, ଉତ୍ପାଦଗୁଡିକ ନିରାପଦ ଏବଂ ସୁଗମ ଭାବରେ ଆପଣଙ୍କ ହାତରେ ବିତରଣ କରିପାରିବା | ଦେୟ ନିଶ୍ଚିତ ହେବା ପରେ ବିତରଣ ସମୟ ପ୍ରାୟ 3-20 ଦିନ ଅଟେ |
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS: | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
ତରଳିବା ବିନ୍ଦୁ | | >90°C (dec.) |
ଫୁଟିବା ବିନ୍ଦୁ | | 873.5±65.0 °C(Predicted) |
ଘନତା | 1.088±0.06 g/cm3(Predicted) |
ଷ୍ଟୋରେଜ୍ ଟେମ୍ପ୍ | | -20°C Freezer |
ଦ୍ରବଣୀୟତା | | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
ଫର୍ମ | Solid |
ରଙ୍ଗ | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. ଆପଣ ଏକ କାରଖାନା ନା ଏକ ବାଣିଜ୍ୟ କମ୍ପାନୀ?
ଆମେ ଏକ କମ୍ପନେ ଶିଳ୍ପ ଏବଂ ବାଣିଜ୍ୟକୁ ଏକୀକୃତ କରି ଏକ ଷ୍ଟପ୍ ସେବା ପ୍ରଦାନ କରୁଛୁ | OEM ଗ୍ରହଣ କରାଯାଇପାରେ |
2. ଆପଣ ନମୁନା ପ୍ରଦାନ କରନ୍ତି କି? ଏହା ମାଗଣା କି ଅତିରିକ୍ତ?
ମାଗଣା ନମୁନା | ନମୁନାର ମାଲ ପରିବହନ ଫି ଆପଣଙ୍କ ପକ୍ଷରେ ଦେବାକୁ ପଡିବ |
3. ଗୁଣାତ୍ମକ ନିୟନ୍ତ୍ରଣ ସହିତ ଆପଣଙ୍କର କ cert ଣସି ପ୍ରମାଣପତ୍ର ଅଛି କି?
ଗୁଣବତ୍ତା ନିଶ୍ଚିତ କରିବାକୁ ISO 9001: 2008 ପ୍ରମାଣପତ୍ର |
4. ଏକ ଉଦ୍ଧୃତି ପାଇବା ପାଇଁ ମୁଁ କ’ଣ ପ୍ରଦାନ କରିବି?
Pls ଆମକୁ ଆବଶ୍ୟକ କରୁଥିବା ଉତ୍ପାଦ ପ୍ରକାର ବିଷୟରେ ସୂଚନା ଦିଅ, ପରିମାଣ, ଠିକଣା ଏବଂ ନିର୍ଦ୍ଦିଷ୍ଟ ଆବଶ୍ୟକତା ଅର୍ଡର କର | ତୁମର ରେଫରେନ୍ସ ପାଇଁ କୋଟେସନ୍ ଠିକ୍ ସମୟରେ ପ୍ରସ୍ତୁତ ହେବ |
5. ଆପଣ କେଉଁ ପ୍ରକାର ଦେୟ ପଦ୍ଧତି ପସନ୍ଦ କରନ୍ତି? କେଉଁ ପ୍ରକାର ସର୍ତ୍ତ ଗ୍ରହଣ କରାଯାଏ?
ଗ୍ରହଣ କରାଯାଇଥିବା ବିତରଣ ସର୍ତ୍ତାବଳୀ: FOB, CFR, CIF, EXW;
Accepted Payment Currency:USD;EUR
ଗ୍ରହଣ କରାଯାଇଥିବା ଦେୟ ପ୍ରକାର: ଟି / ଟି, ୱେଷ୍ଟର୍ଣ୍ଣ ୟୁନିଅନ୍; ପେପାଲ୍, ବାଣିଜ୍ୟ ନିଶ୍ଚିତତା |
ଭାଷା ସ୍ପୋକେନ୍: ଇଂରାଜୀ |
ଉତ୍ପାଦ ବର୍ଗଗୁଡିକ |