MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
ഞങ്ങൾക്ക് ആഴത്തിലുള്ള സഹകരണത്തോടെ ഉയർന്ന നിലവാരമുള്ള നിരവധി ഫാക്ടറികൾ ഉണ്ട്, അത് നിങ്ങൾക്ക് ഉയർന്ന നിലവാരമുള്ള ഉൽപ്പന്നങ്ങളും മത്സരാധിഷ്ഠിത വിലകളും പ്രദാനം ചെയ്യാൻ കഴിയും. ബൾക്ക് പർച്ചേസുകൾക്കും ഞങ്ങൾക്ക് കിഴിവുകൾ നൽകാം. കൂടാതെ നിരവധി പ്രൊഫഷണൽ ചരക്ക് ഫോർവേഡിംഗ് കമ്പനികളുമായി ഞങ്ങൾ സഹകരിക്കുന്നു, ഉൽപ്പന്നങ്ങൾ സുരക്ഷിതമായും സുഗമമായും നിങ്ങളുടെ കൈകളിലേക്ക് എത്തിക്കാൻ കഴിയും. പേയ്മെൻ്റ് സ്ഥിരീകരിച്ചതിന് ശേഷം ഏകദേശം 3-20 ദിവസമാണ് ഡെലിവറി സമയം.
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS: | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
ദ്രവണാങ്കം | >90°C (dec.) |
തിളയ്ക്കുന്ന പോയിൻ്റ് | 873.5±65.0 °C(Predicted) |
സാന്ദ്രത | 1.088±0.06 g/cm3(Predicted) |
സംഭരണ താപനില. | -20°C Freezer |
ദ്രവത്വം | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
രൂപം | Solid |
നിറം | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. നിങ്ങളൊരു ഫാക്ടറിയാണോ അതോ വ്യാപാര കമ്പനിയാണോ?
ഞങ്ങൾ വ്യവസായവും വ്യാപാരവും സമന്വയിപ്പിക്കുന്ന ഒരു കമ്പനിയാണ്, ഒറ്റത്തവണ സേവനം നൽകുന്നു.OEM സ്വീകരിക്കാവുന്നതാണ്.
2. നിങ്ങൾ സാമ്പിളുകൾ നൽകുന്നുണ്ടോ? ഇത് സൗജന്യമാണോ അതോ അധികമാണോ?
സൗജന്യ സാമ്പിളുകൾ. സാമ്പിളിൻ്റെ ചരക്ക് ഫീസ് നിങ്ങളുടെ ഭാഗത്ത് നിന്ന് നൽകേണ്ടതുണ്ട്.
3. ഗുണനിലവാര നിയന്ത്രണവുമായി ബന്ധപ്പെട്ട എന്തെങ്കിലും സർട്ടിഫിക്കറ്റുകൾ നിങ്ങളുടെ പക്കലുണ്ടോ?
ഗുണനിലവാരം ഉറപ്പാക്കാൻ ISO 9001:2008 സർട്ടിഫിക്കേഷൻ.
4. ഒരു ഉദ്ധരണി ലഭിക്കാൻ ഞാൻ എന്താണ് നൽകേണ്ടത്?
നിങ്ങൾക്ക് ആവശ്യമുള്ള ഉൽപ്പന്ന തരം, ഓർഡർ അളവ്, വിലാസം, നിർദ്ദിഷ്ട ആവശ്യകതകൾ എന്നിവയെക്കുറിച്ച് ദയവായി ഞങ്ങളെ അറിയിക്കുക. നിങ്ങളുടെ റഫറൻസിനായി ഉദ്ധരണി കൃത്യസമയത്ത് നടത്തും.
5. ഏത് തരത്തിലുള്ള പേയ്മെൻ്റ് രീതിയാണ് നിങ്ങൾ ഇഷ്ടപ്പെടുന്നത്? ഏത് തരത്തിലുള്ള നിബന്ധനകളാണ് സ്വീകരിക്കുന്നത്?
അംഗീകൃത ഡെലിവറി നിബന്ധനകൾ: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
സ്വീകരിച്ച പേയ്മെൻ്റ് തരം: T/T, വെസ്റ്റേൺ യൂണിയൻ; പേപാൽ, ട്രേഡ് അഷ്വറൻസ്.
സംസാരിക്കുന്ന ഭാഷ: ഇംഗ്ലീഷ്.
ഉൽപ്പന്ന വിഭാഗങ്ങൾ