MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
יש לנו הרבה מפעלים איכותיים עם שיתוף פעולה עמוק, שיכולים לספק לכם מוצרים באיכות גבוהה ומחירים תחרותיים. ואנחנו יכולים גם לתת הנחות עבור רכישות בכמויות גדולות. ואנו משתפים פעולה עם חברות שילוח מקצועיות רבות, יכולים לספק מוצרים בבטחה וחלקה לידיים שלך. זמן אספקה הוא כ 3-20 ימים לאחר אישור התשלום.
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS: | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
נקודת התכה | >90°C (dec.) |
נקודת רתיחה | 873.5±65.0 °C(Predicted) |
צְפִיפוּת | 1.088±0.06 g/cm3(Predicted) |
טמפרטורת אחסון. | -20°C Freezer |
מְסִיסוּת | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
טוֹפֶס | Solid |
צֶבַע | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. האם אתה מפעל או חברת סחר?
אנחנו חברה המשלבת תעשייה ומסחר, מספקת שירות חד פעמי. OEM יכול להתקבל.
2. האם אתה מספק דוגמאות? האם זה בחינם או נוסף?
דגימות חינם. יש לשלם את דמי ההובלה של המדגם לצדך.
3. האם יש לך תעודות הקשורות לבקרת איכות?
אישור ISO 9001:2008 להבטחת איכות.
4. מה עלי לספק כדי לקבל הצעת מחיר?
אנא הודע לנו על סוג המוצר שאתה צריך, כמות הזמנה, כתובת ודרישות ספציפיות. הצעת המחיר תבוצע לעיונך בזמן.
5. איזה סוג של שיטת תשלום אתה מעדיף? איזה סוג של תנאים מקובלים?
תנאי משלוח מקובלים: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
סוג תשלום מקובל: T/T, ווסטרן יוניון; Paypal, אבטחת סחר.
שפה מדוברת: אנגלית.
קטגוריות מוצרים