MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
우리는 고품질의 제품과 경쟁력 있는 가격을 제공할 수 있는 깊은 협력을 바탕으로 많은 고품질 공장을 보유하고 있습니다. 또한 대량 구매 시 할인 혜택도 제공할 수 있습니다. 또한 많은 전문 화물 운송 회사와 협력하여 안전하고 원활하게 제품을 귀하의 손에 전달할 수 있습니다. 배송기간은 결제 확인 후 약 3~20일 정도 소요됩니다.
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS: | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
녹는점 | >90°C (dec.) |
비등점 | 873.5±65.0 °C(Predicted) |
밀도 | 1.088±0.06 g/cm3(Predicted) |
보관온도 | -20°C Freezer |
용해도 | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
형태 | Solid |
색상 | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. 당신은 공장입니까 아니면 무역 회사입니까?
우리는 원스톱 서비스를 제공하는 산업과 무역을 통합하는 회사입니다. OEM이 허용될 수 있습니다.
2. 샘플을 제공합니까? 무료인가요 아니면 추가인가요?
무료 샘플. 샘플의 운임은 귀하가 지불해야 합니다.
3. 품질관리 관련 인증서가 있나요?
ISO 9001:2008 인증으로 품질을 보장합니다.
4. 견적을 받으려면 무엇을 제공해야 합니까?
Pls는 귀하가 필요로 하는 제품 유형, 주문 수량, 주소 및 특정 요구 사항을 알려줍니다. 견적은 귀하의 참조를 위해 제 시간에 작성될 것입니다.
5. 어떤 종류의 결제 방식을 선호하시나요? 어떤 종류의 조건이 허용되나요?
허용되는 배송 조건: FOB,CFR,CIF,EXW;
Accepted Payment Currency:USD;EUR
허용되는 지불 유형: T/T, 서부 동맹; 페이팔, 무역 보증.
사용언어:영어.
제품 카테고리