MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
MMAE is an effective and synthetic cytotoxic analog of Dolastatin 10 which is a potent antimitotic polypeptide isolated from a marine animal.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
យើងមានរោងចក្រដែលមានគុណភាពខ្ពស់ជាច្រើនជាមួយនឹងកិច្ចសហប្រតិបត្តិការយ៉ាងស៊ីជម្រៅ ដែលអាចផ្តល់ឱ្យអ្នកនូវផលិតផលដែលមានគុណភាពខ្ពស់ និងតម្លៃប្រកួតប្រជែង។ ហើយយើងក៏អាចផ្តល់ការបញ្ចុះតម្លៃសម្រាប់ការទិញច្រើនផងដែរ។ហើយយើងសហការជាមួយក្រុមហ៊ុនដឹកជញ្ជូនដែលមានជំនាញវិជ្ជាជីវៈជាច្រើន អាចចែកចាយផលិតផលដោយសុវត្ថិភាព និងរលូនដល់ដៃរបស់អ្នក។ ពេលវេលាដឹកជញ្ជូនគឺប្រហែល 3-20 ថ្ងៃបន្ទាប់ពីការបញ្ជាក់ការទូទាត់។
Product Name: | MonoMethyl auristatin E |
Synonyms: | MonoMethyl auristatin E(MMAE, vedotin);HM-297C-22;MonoMethyl auristatin E;MMAE;Vedotin;N-Methyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl-L-valinamide Monomethyl;Monomethyl auristatin E, >=98%;(S)-N-((3R,4S,5S)-1-((S)-2-((1R,2R)-3-(((1R,2R)-1-Hydroxy-1-phenylpropan-2-yl)amino)-1-methoxy-2-methyl-3-oxopropyl)pyrrolidin-1-yl)-3-methoxy-5-methyl-1-oxohe |
CAS៖ | 474645-27-7 |
MF: | C39H67N5O7 |
MW: | 717.98 |
EINECS: | |
Product Categories: | intermediates;Pharmaceutical; |
Mol File: | 474645-27-7.mol |
![]() |
MonoMethyl auristatin E Chemical Properties |
ចំណុចរលាយ | >90°C (dec.) |
ចំណុចរំពុះ | 873.5±65.0 °C(Predicted) |
ដង់ស៊ីតេ | 1.088±0.06 g/cm3(Predicted) |
សីតុណ្ហភាពផ្ទុក។ | -20°C Freezer |
ភាពរលាយ | DMSO (Slightly), Methanol (Slightly, Sonicated) |
pka | 13.66±0.20(Predicted) |
ទម្រង់ | Solid |
ពណ៌ | White to Off-White |
InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
CAS DataBase Reference | 474645-27-7 |
1. តើអ្នកជារោងចក្រ ឬក្រុមហ៊ុនពាណិជ្ជកម្ម?
យើងជាក្រុមហ៊ុនរួមបញ្ចូលគ្នានូវឧស្សាហកម្ម និងពាណិជ្ជកម្ម ដែលផ្តល់សេវាកម្មតែម្តង។ OEM អាចទទួលយកបាន។
2. តើអ្នកផ្តល់គំរូទេ? តើវាឥតគិតថ្លៃ ឬបន្ថែម?
សំណាកគំរូឥតគិតថ្លៃ។ ថ្លៃដឹកជញ្ជូនគំរូត្រូវបង់ដោយភាគីអ្នក។
3. តើអ្នកមានវិញ្ញាបនបត្រទាក់ទងនឹងការត្រួតពិនិត្យគុណភាពទេ?
វិញ្ញាបនប័ត្រ ISO 9001: 2008 ដើម្បីធានាគុណភាព។
4. តើខ្ញុំគួរផ្តល់អ្វីដើម្បីទទួលបានសម្រង់?
Pls ប្រាប់យើងអំពីប្រភេទផលិតផលដែលអ្នកត្រូវការ បរិមាណបញ្ជាទិញ អាសយដ្ឋាន និងតម្រូវការជាក់លាក់។ សម្រង់នឹងត្រូវបានធ្វើឡើងសម្រាប់ជាឯកសារយោងរបស់អ្នកទាន់ពេលវេលា។
5. តើអ្នកចូលចិត្តវិធីបង់ប្រាក់បែបណា? តើលក្ខខណ្ឌបែបណាដែលត្រូវទទួលយក?
លក្ខខណ្ឌដឹកជញ្ជូនដែលទទួលយក៖ FOB, CFR, CIF, EXW;
Accepted Payment Currency:USD;EUR
ប្រភេទការទូទាត់ដែលបានទទួលយក: T / T, Western Union; Paypal, ការធានាពាណិជ្ជកម្ម។
ភាសានិយាយ៖ អង់គ្លេស។
ប្រភេទផលិតផល